2-Bromo-5-thiazolecarboxylic acid
Catalog No: FT-0640216
CAS No: 54045-76-0
- Chemical Name: 2-Bromo-5-thiazolecarboxylic acid
- Molecular Formula: C4H2BrNO2S
- Molecular Weight: 208.04
- InChI Key: BESGTWHUMYHYEQ-UHFFFAOYSA-N
- InChI: InChI=1S/C4H2BrNO2S/c5-4-6-1-2(9-4)3(7)8/h1H,(H,7,8)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 54045-76-0 |
| Flash_Point: | 165.5±20.4 °C |
| Product_Name: | 2-Bromothiazole-5-carboxylic acid |
| Bolling_Point: | 350.0±15.0 °C at 760 mmHg |
| FW: | 208.033 |
| Melting_Point: | 182ºC (dec.) |
| MF: | C4H2BrNO2S |
| Density: | 2.1±0.1 g/cm3 |
| Refractive_Index: | 1.663 |
|---|---|
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Flash_Point: | 165.5±20.4 °C |
| LogP: | 1.60 |
| Bolling_Point: | 350.0±15.0 °C at 760 mmHg |
| FW: | 208.033 |
| PSA: | 78.43000 |
| Melting_Point: | 182ºC (dec.) |
| MF: | C4H2BrNO2S |
| Exact_Mass: | 206.898956 |
| Density: | 2.1±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R43 |
| HS_Code: | 2934100090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi:Irritant; |
| Warning_Statement: | P280 |
| Safety_Statements: | H317 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)